C21H42NO6P — CID 15872431
[2-hydroxy-3-[[(Z)-octadec-9-enoyl]amino]propyl] dihydrogen phosphate (PubChem CID 15872431) has the molecular formula C21H42NO6P and a molecular weight of 435.54 g/mol. Its IUPAC name is [2-hydroxy-3-[[(Z)-octadec-9-enoyl]amino]propyl] dihydrogen phosphate.
| Compound Name | [2-hydroxy-3-[[(Z)-octadec-9-enoyl]amino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 15872431 |
| Molecular Formula | C21H42NO6P |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | [2-hydroxy-3-[[(Z)-octadec-9-enoyl]amino]propyl] dihydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C21H42NO6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)22-18-20(23)19-28-29(25,26)27/h9-10,20,23H,2-8,11-19H2,1H3,(H,22,24)(H2,25,26,27)/b10-9- |
| InChIKey | BSZDAOYUNAQCDP-KTKRTIGZSA-N |
| XLogP | 4.61 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|