C15H28O2 — CID 126723997
(3S,4S,5R,6R,7S,8S)-8-methoxy-3,5,6,7-tetramethyldec-1-yn-4-ol (PubChem CID 126723997) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (3S,4S,5R,6R,7S,8S)-8-methoxy-3,5,6,7-tetramethyldec-1-yn-4-ol.
| Compound Name | (3S,4S,5R,6R,7S,8S)-8-methoxy-3,5,6,7-tetramethyldec-1-yn-4-ol |
|---|---|
| PubChem CID | 126723997 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (3S,4S,5R,6R,7S,8S)-8-methoxy-3,5,6,7-tetramethyldec-1-yn-4-ol |
| SMILES | C#C[C@H](C)[C@@H](O)[C@H](C)[C@@H](C)[C@H](C)[C@H](CC)OC |
| InChI | InChI=1S/C15H28O2/c1-8-10(3)15(16)13(6)11(4)12(5)14(9-2)17-7/h1,10-16H,9H2,2-7H3/t10-,11-,12-,13+,14-,15+/m0/s1 |
| InChIKey | VZEZTCKGLICFPJ-CTTWBBHYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|