C8H14N2O — CID 126729438
2-methoxy-1,3-diazaspiro[3.5]non-2-ene (PubChem CID 126729438) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-methoxy-1,3-diazaspiro[3.5]non-2-ene.
| Compound Name | 2-methoxy-1,3-diazaspiro[3.5]non-2-ene |
|---|---|
| PubChem CID | 126729438 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-methoxy-1,3-diazaspiro[3.5]non-2-ene |
| SMILES | COC1=NC2(CCCCC2)N1 |
| InChI | InChI=1S/C8H14N2O/c1-11-7-9-8(10-7)5-3-2-4-6-8/h2-6H2,1H3,(H,9,10) |
| InChIKey | QUSYZBUYTOTQHH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |