C18H23N3O4 — CID 135528688
diethyl 2-spiro[3H-imidazo[4,5-b]pyridine-2,1'-cyclohexane]-5-ylidenepropanedioate (PubChem CID 135528688) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is diethyl 2-spiro[3H-imidazo[4,5-b]pyridine-2,1'-cyclohexane]-5-ylidenepropanedioate.
| Compound Name | diethyl 2-spiro[3H-imidazo[4,5-b]pyridine-2,1'-cyclohexane]-5-ylidenepropanedioate |
|---|---|
| PubChem CID | 135528688 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | diethyl 2-spiro[3H-imidazo[4,5-b]pyridine-2,1'-cyclohexane]-5-ylidenepropanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=c1ccc2c(n1)NC1(CCCCC1)N=2 |
| InChI | InChI=1S/C18H23N3O4/c1-3-24-16(22)14(17(23)25-4-2)12-8-9-13-15(19-12)21-18(20-13)10-6-5-7-11-18/h8-9H,3-7,10-11H2,1-2H3,(H,19,21) |
| InChIKey | CDFJYCQBGDGTQR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|