C34H47NO6 — CID 126732971
methyl (4aS,6aR,6bS,9S,12aS,14aR,14bS)-11-cyano-9-(2-methoxy-2-oxoethyl)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate (PubChem CID 126732971) has the molecular formula C34H47NO6 and a molecular weight of 565.75 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,9S,12aS,14aR,14bS)-11-cyano-9-(2-methoxy-2-oxoethyl)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,9S,12aS,14aR,14bS)-11-cyano-9-(2-methoxy-2-oxoethyl)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 126732971 |
| Molecular Formula | C34H47NO6 |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | methyl (4aS,6aR,6bS,9S,12aS,14aR,14bS)-11-cyano-9-(2-methoxy-2-oxoethyl)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate |
| SMILES | COC(=O)C[C@]1(C)C(=O)C(C#N)C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C(=O)OC)CC[C@@]4(C)[C@]3(C)CCC12 |
| InChI | InChI=1S/C34H47NO6/c1-29(2)11-13-34(28(39)41-8)14-12-33(6)26(21(34)17-29)22(36)15-24-30(3)16-20(19-35)27(38)31(4,18-25(37)40-7)23(30)9-10-32(24,33)5/h15,20-21,23,26H,9-14,16-18H2,1-8H3/t20?,21-,23?,26-,30-,31-,32+,33+,34-/m0/s1 |
| InChIKey | NKJGIRBAJDTXJK-GJCAWSATSA-N |
| XLogP | 6.00 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|