C22H48N+ — CID 126735328
2,2-dimethylpropyl-bis(2-ethylhexyl)-methylazanium (PubChem CID 126735328) has the molecular formula C22H48N+ and a molecular weight of 326.63 g/mol. Its IUPAC name is 2,2-dimethylpropyl-bis(2-ethylhexyl)-methylazanium.
| Compound Name | 2,2-dimethylpropyl-bis(2-ethylhexyl)-methylazanium |
|---|---|
| PubChem CID | 126735328 |
| Molecular Formula | C22H48N+ |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.38 |
| IUPAC Name | 2,2-dimethylpropyl-bis(2-ethylhexyl)-methylazanium |
| SMILES | CCCCC(CC)C[N+](C)(CC(CC)CCCC)CC(C)(C)C |
| InChI | InChI=1S/C22H48N/c1-9-13-15-20(11-3)17-23(8,19-22(5,6)7)18-21(12-4)16-14-10-2/h20-21H,9-19H2,1-8H3/q+1 |
| InChIKey | DOWKYZBZWRWVEU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|