C20H21BrN2O3 — CID 126738314
N-(3-bromopropyl)-3-(6,7-dimethoxyquinolin-4-yl)oxyaniline (PubChem CID 126738314) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is N-(3-bromopropyl)-3-(6,7-dimethoxyquinolin-4-yl)oxyaniline.
| Compound Name | N-(3-bromopropyl)-3-(6,7-dimethoxyquinolin-4-yl)oxyaniline |
|---|---|
| PubChem CID | 126738314 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-(3-bromopropyl)-3-(6,7-dimethoxyquinolin-4-yl)oxyaniline |
| SMILES | COc1cc2nccc(Oc3cccc(NCCCBr)c3)c2cc1OC |
| InChI | InChI=1S/C20H21BrN2O3/c1-24-19-12-16-17(13-20(19)25-2)23-10-7-18(16)26-15-6-3-5-14(11-15)22-9-4-8-21/h3,5-7,10-13,22H,4,8-9H2,1-2H3 |
| InChIKey | YTFGAEWNXYVUBF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|