C16H28OS2 — CID 126748281
3-methyl-7-propoxy-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene-4-thiol (PubChem CID 126748281) has the molecular formula C16H28OS2 and a molecular weight of 300.53 g/mol. Its IUPAC name is 3-methyl-7-propoxy-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene-4-thiol.
| Compound Name | 3-methyl-7-propoxy-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene-4-thiol |
|---|---|
| PubChem CID | 126748281 |
| Molecular Formula | C16H28OS2 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-methyl-7-propoxy-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene-4-thiol |
| SMILES | CCCOC1CCC2C(C1)SC1C(S)C(C)CCC21 |
| InChI | InChI=1S/C16H28OS2/c1-3-8-17-11-5-7-12-13-6-4-10(2)15(18)16(13)19-14(12)9-11/h10-16,18H,3-9H2,1-2H3 |
| InChIKey | FHACVNXYRMTVJN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|