C15H26OS — CID 126748207
7-methoxy-3,4-dimethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene (PubChem CID 126748207) has the molecular formula C15H26OS and a molecular weight of 254.44 g/mol. Its IUPAC name is 7-methoxy-3,4-dimethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene.
| Compound Name | 7-methoxy-3,4-dimethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene |
|---|---|
| PubChem CID | 126748207 |
| Molecular Formula | C15H26OS |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 7-methoxy-3,4-dimethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene |
| SMILES | COC1CCC2C(C1)SC1C(C)C(C)CCC21 |
| InChI | InChI=1S/C15H26OS/c1-9-4-6-13-12-7-5-11(16-3)8-14(12)17-15(13)10(9)2/h9-15H,4-8H2,1-3H3 |
| InChIKey | OQHBYSSKFFEXGC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |