C17H30O2 — CID 146330950
3,4-dimethyl-7-propoxy-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran (PubChem CID 146330950) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 3,4-dimethyl-7-propoxy-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran.
| Compound Name | 3,4-dimethyl-7-propoxy-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran |
|---|---|
| PubChem CID | 146330950 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 3,4-dimethyl-7-propoxy-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzofuran |
| SMILES | CCCOC1CCC2C(C1)OC1C(C)C(C)CCC21 |
| InChI | InChI=1S/C17H30O2/c1-4-9-18-13-6-8-14-15-7-5-11(2)12(3)17(15)19-16(14)10-13/h11-17H,4-10H2,1-3H3 |
| InChIKey | MVBVYFPKPVFFIS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |