C13H31N5O4 — CID 126755953
1,2-bis[2-[2-(2-aminoethoxy)ethoxy]ethyl]guanidine (PubChem CID 126755953) has the molecular formula C13H31N5O4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1,2-bis[2-[2-(2-aminoethoxy)ethoxy]ethyl]guanidine.
| Compound Name | 1,2-bis[2-[2-(2-aminoethoxy)ethoxy]ethyl]guanidine |
|---|---|
| PubChem CID | 126755953 |
| Molecular Formula | C13H31N5O4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 1,2-bis[2-[2-(2-aminoethoxy)ethoxy]ethyl]guanidine |
| SMILES | NCCOCCOCC/N=C(\N)NCCOCCOCCN |
| InChI | InChI=1S/C13H31N5O4/c14-1-5-19-9-11-21-7-3-17-13(16)18-4-8-22-12-10-20-6-2-15/h1-12,14-15H2,(H3,16,17,18) |
| InChIKey | LCCVINYUOKWADU-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|