C10H18N2O5 — CID 12678065
1,4,10-trioxa-7,13-diazacyclopentadecane-8,12-dione (PubChem CID 12678065) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1,4,10-trioxa-7,13-diazacyclopentadecane-8,12-dione.
| Compound Name | 1,4,10-trioxa-7,13-diazacyclopentadecane-8,12-dione |
|---|---|
| PubChem CID | 12678065 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1,4,10-trioxa-7,13-diazacyclopentadecane-8,12-dione |
| SMILES | O=C1COCC(=O)NCCOCCOCCN1 |
| InChI | InChI=1S/C10H18N2O5/c13-9-7-17-8-10(14)12-2-4-16-6-5-15-3-1-11-9/h1-8H2,(H,11,13)(H,12,14) |
| InChIKey | VNJRSWBKYXDKQZ-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |