C8H13F2NO2S — CID 126794536
1-[3-(difluoromethyl)-3-hydroxyazetidin-1-yl]-2-methylsulfanylpropan-1-one (PubChem CID 126794536) has the molecular formula C8H13F2NO2S and a molecular weight of 225.26 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-3-hydroxyazetidin-1-yl]-2-methylsulfanylpropan-1-one.
| Compound Name | 1-[3-(difluoromethyl)-3-hydroxyazetidin-1-yl]-2-methylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 126794536 |
| Molecular Formula | C8H13F2NO2S |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1-[3-(difluoromethyl)-3-hydroxyazetidin-1-yl]-2-methylsulfanylpropan-1-one |
| SMILES | CSC(C)C(=O)N1CC(O)(C(F)F)C1 |
| InChI | InChI=1S/C8H13F2NO2S/c1-5(14-2)6(12)11-3-8(13,4-11)7(9)10/h5,7,13H,3-4H2,1-2H3 |
| InChIKey | HEKDQRINJINNTO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |