C12H12F2N4O2S2 — CID 126797435
5-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-1,2,4-thiadiazole (PubChem CID 126797435) has the molecular formula C12H12F2N4O2S2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 5-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-1,2,4-thiadiazole.
| Compound Name | 5-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 126797435 |
| Molecular Formula | C12H12F2N4O2S2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 5-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-1,2,4-thiadiazole |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1CCN(c2ncns2)CC1 |
| InChI | InChI=1S/C12H12F2N4O2S2/c13-9-1-2-10(14)11(7-9)22(19,20)18-5-3-17(4-6-18)12-15-8-16-21-12/h1-2,7-8H,3-6H2 |
| InChIKey | WPARERBTSKXSKE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |