C16H16BrF2N3O2S — CID 133373089
1-(5-bromo-3-methyl-2-pyridinyl)-4-(2,5-difluorophenyl)sulfonylpiperazine (PubChem CID 133373089) has the molecular formula C16H16BrF2N3O2S and a molecular weight of 432.29 g/mol. Its IUPAC name is 1-(5-bromo-3-methyl-2-pyridinyl)-4-(2,5-difluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(5-bromo-3-methyl-2-pyridinyl)-4-(2,5-difluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 133373089 |
| Molecular Formula | C16H16BrF2N3O2S |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 1-(5-bromo-3-methyl-2-pyridinyl)-4-(2,5-difluorophenyl)sulfonylpiperazine |
| SMILES | Cc1cc(Br)cnc1N1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C16H16BrF2N3O2S/c1-11-8-12(17)10-20-16(11)21-4-6-22(7-5-21)25(23,24)15-9-13(18)2-3-14(15)19/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | QFIPCZZXSXKDTB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |