C17H14BrF2N3O2S — CID 133407955
3-bromo-4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]benzonitrile (PubChem CID 133407955) has the molecular formula C17H14BrF2N3O2S and a molecular weight of 442.29 g/mol. Its IUPAC name is 3-bromo-4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]benzonitrile.
| Compound Name | 3-bromo-4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133407955 |
| Molecular Formula | C17H14BrF2N3O2S |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | 3-bromo-4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN(S(=O)(=O)c3cc(F)ccc3F)CC2)c(Br)c1 |
| InChI | InChI=1S/C17H14BrF2N3O2S/c18-14-9-12(11-21)1-4-16(14)22-5-7-23(8-6-22)26(24,25)17-10-13(19)2-3-15(17)20/h1-4,9-10H,5-8H2 |
| InChIKey | UFHARBKWYQWKLC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |