C20H19F2N3O2S — CID 133467536
4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-methylquinoline (PubChem CID 133467536) has the molecular formula C20H19F2N3O2S and a molecular weight of 403.45 g/mol. Its IUPAC name is 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-methylquinoline.
| Compound Name | 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-methylquinoline |
|---|---|
| PubChem CID | 133467536 |
| Molecular Formula | C20H19F2N3O2S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-methylquinoline |
| SMILES | Cc1ccc2nccc(N3CCN(S(=O)(=O)c4cc(F)ccc4F)CC3)c2c1 |
| InChI | InChI=1S/C20H19F2N3O2S/c1-14-2-5-18-16(12-14)19(6-7-23-18)24-8-10-25(11-9-24)28(26,27)20-13-15(21)3-4-17(20)22/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | NKIRKHKAGXCLFN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |