C24H31N3O2S — CID 126799309
2-methyl-1-[4-[4-(2-methyl-1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazolidin-3-yl]pent-2-en-1-one (PubChem CID 126799309) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is 2-methyl-1-[4-[4-(2-methyl-1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazolidin-3-yl]pent-2-en-1-one.
| Compound Name | 2-methyl-1-[4-[4-(2-methyl-1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazolidin-3-yl]pent-2-en-1-one |
|---|---|
| PubChem CID | 126799309 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-methyl-1-[4-[4-(2-methyl-1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazolidin-3-yl]pent-2-en-1-one |
| SMILES | CCC=C(C)C(=O)N1CSCC1C(=O)N1CCC(c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C24H31N3O2S/c1-4-7-16(2)23(28)27-15-30-14-21(27)24(29)26-12-10-18(11-13-26)22-17(3)25-20-9-6-5-8-19(20)22/h5-9,18,21,25H,4,10-15H2,1-3H3 |
| InChIKey | GIRCSCFURLNXGS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|