About 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one
6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one (PubChem CID 126802115) has the molecular formula C17H21ClN2O2
and a molecular weight of 320.82 g/mol. Its IUPAC name is 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one.
Molecular Properties
| Compound Name | 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one |
| PubChem CID | 126802115 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one |
| SMILES | CC1(C)CN(C(=O)CC2CCCC(=O)N2)c2cccc(Cl)c21 |
| InChI | InChI=1S/C17H21ClN2O2/c1-17(2)10-20(13-7-4-6-12(18)16(13)17)15(22)9-11-5-3-8-14(21)19-11/h4,6-7,11H,3,5,8-10H2,1-2H3,(H,19,21) |
| InChIKey | NBUKPLXOGMQXCB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one?
The IUPAC name of 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one (CID 126802115) is 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one.
What is the SMILES notation for 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one?
The canonical SMILES for 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one is CC1(C)CN(C(=O)CC2CCCC(=O)N2)c2cccc(Cl)c21.
What is the InChIKey of 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one?
The InChIKey is NBUKPLXOGMQXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2O2/c1-17(2)10-20(13-7-4-6-12(18)16(13)17)15(22)9-11-5-3-8-14(21)19-11/h4,6-7,11H,3,5,8-10H2,1-2H3,(H,19,21).
What are the key properties of 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one?
6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one has a molecular weight of 320.82 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one is sourced from PubChem (CID 126802115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).