C17H21ClN2O2 — CID 126802115
6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one (PubChem CID 126802115) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one.
| Compound Name | 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one |
|---|---|
| PubChem CID | 126802115 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 6-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]piperidin-2-one |
| SMILES | CC1(C)CN(C(=O)CC2CCCC(=O)N2)c2cccc(Cl)c21 |
| InChI | InChI=1S/C17H21ClN2O2/c1-17(2)10-20(13-7-4-6-12(18)16(13)17)15(22)9-11-5-3-8-14(21)19-11/h4,6-7,11H,3,5,8-10H2,1-2H3,(H,19,21) |
| InChIKey | NBUKPLXOGMQXCB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |