C13H13N3O4S — CID 126802633
N-(2,5-dimethylfuran-3-yl)sulfonyl-3-pyrimidin-4-ylprop-2-enamide (PubChem CID 126802633) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is N-(2,5-dimethylfuran-3-yl)sulfonyl-3-pyrimidin-4-ylprop-2-enamide.
| Compound Name | N-(2,5-dimethylfuran-3-yl)sulfonyl-3-pyrimidin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 126802633 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-(2,5-dimethylfuran-3-yl)sulfonyl-3-pyrimidin-4-ylprop-2-enamide |
| SMILES | Cc1cc(S(=O)(=O)NC(=O)C=Cc2ccncn2)c(C)o1 |
| InChI | InChI=1S/C13H13N3O4S/c1-9-7-12(10(2)20-9)21(18,19)16-13(17)4-3-11-5-6-14-8-15-11/h3-8H,1-2H3,(H,16,17) |
| InChIKey | OBBZHFUCONRRSM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|