C20H19N3O4 — CID 126805231
(2S,3S)-N'-[2-(1,2-benzoxazol-3-yl)acetyl]-2-phenyloxolane-3-carbohydrazide (PubChem CID 126805231) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2S,3S)-N'-[2-(1,2-benzoxazol-3-yl)acetyl]-2-phenyloxolane-3-carbohydrazide.
| Compound Name | (2S,3S)-N'-[2-(1,2-benzoxazol-3-yl)acetyl]-2-phenyloxolane-3-carbohydrazide |
|---|---|
| PubChem CID | 126805231 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (2S,3S)-N'-[2-(1,2-benzoxazol-3-yl)acetyl]-2-phenyloxolane-3-carbohydrazide |
| SMILES | O=C(Cc1noc2ccccc12)NNC(=O)[C@H]1CCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19N3O4/c24-18(12-16-14-8-4-5-9-17(14)27-23-16)21-22-20(25)15-10-11-26-19(15)13-6-2-1-3-7-13/h1-9,15,19H,10-12H2,(H,21,24)(H,22,25)/t15-,19+/m0/s1 |
| InChIKey | WCKJKDQVAPDZHS-HNAYVOBHSA-N |
| XLogP | 2.30 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|