C20H22N2O3 — CID 126816953
N-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]-2-methoxybutanamide (PubChem CID 126816953) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]-2-methoxybutanamide.
| Compound Name | N-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]-2-methoxybutanamide |
|---|---|
| PubChem CID | 126816953 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[1-(1,3-benzoxazol-2-yl)-2-phenylethyl]-2-methoxybutanamide |
| SMILES | CCC(OC)C(=O)NC(Cc1ccccc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C20H22N2O3/c1-3-17(24-2)19(23)21-16(13-14-9-5-4-6-10-14)20-22-15-11-7-8-12-18(15)25-20/h4-12,16-17H,3,13H2,1-2H3,(H,21,23) |
| InChIKey | MMVASKAFLRLYDD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |