C15H23NO6S — CID 126819091
[3-(methoxycarbonylamino)phenyl] 2-methoxy-4-methylpentane-1-sulfonate (PubChem CID 126819091) has the molecular formula C15H23NO6S and a molecular weight of 345.42 g/mol. Its IUPAC name is [3-(methoxycarbonylamino)phenyl] 2-methoxy-4-methylpentane-1-sulfonate.
| Compound Name | [3-(methoxycarbonylamino)phenyl] 2-methoxy-4-methylpentane-1-sulfonate |
|---|---|
| PubChem CID | 126819091 |
| Molecular Formula | C15H23NO6S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [3-(methoxycarbonylamino)phenyl] 2-methoxy-4-methylpentane-1-sulfonate |
| SMILES | COC(=O)Nc1cccc(OS(=O)(=O)CC(CC(C)C)OC)c1 |
| InChI | InChI=1S/C15H23NO6S/c1-11(2)8-14(20-3)10-23(18,19)22-13-7-5-6-12(9-13)16-15(17)21-4/h5-7,9,11,14H,8,10H2,1-4H3,(H,16,17) |
| InChIKey | JXIIHHJPFIRPHS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|