C14H11F6NOS — CID 126820240
N-(1,1,1-trifluorohex-5-yn-3-yl)-3-(trifluoromethylsulfanyl)benzamide (PubChem CID 126820240) has the molecular formula C14H11F6NOS and a molecular weight of 355.30 g/mol. Its IUPAC name is N-(1,1,1-trifluorohex-5-yn-3-yl)-3-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-(1,1,1-trifluorohex-5-yn-3-yl)-3-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 126820240 |
| Molecular Formula | C14H11F6NOS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-(1,1,1-trifluorohex-5-yn-3-yl)-3-(trifluoromethylsulfanyl)benzamide |
| SMILES | C#CCC(CC(F)(F)F)NC(=O)c1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F6NOS/c1-2-4-10(8-13(15,16)17)21-12(22)9-5-3-6-11(7-9)23-14(18,19)20/h1,3,5-7,10H,4,8H2,(H,21,22) |
| InChIKey | CDRRDSZYAIRDTB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|