C21H26N4O — CID 126827701
[(3aS,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]-(1-phenyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)methanone (PubChem CID 126827701) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is [(3aS,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]-(1-phenyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)methanone.
| Compound Name | [(3aS,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]-(1-phenyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 126827701 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [(3aS,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]-(1-phenyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)methanone |
| SMILES | O=C(N1CCc2c(cnn2-c2ccccc2)C1)[C@@]12CCCC[C@@H]1CNC2 |
| InChI | InChI=1S/C21H26N4O/c26-20(21-10-5-4-6-17(21)13-22-15-21)24-11-9-19-16(14-24)12-23-25(19)18-7-2-1-3-8-18/h1-3,7-8,12,17,22H,4-6,9-11,13-15H2/t17-,21-/m1/s1 |
| InChIKey | LDHFCDWFUZBDBY-DYESRHJHSA-N |
| XLogP | 2.54 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |