C14H21N3O5S — CID 126832517
tert-butyl 6-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]pyridine-3-carboxylate (PubChem CID 126832517) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is tert-butyl 6-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]pyridine-3-carboxylate.
| Compound Name | tert-butyl 6-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126832517 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | tert-butyl 6-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]pyridine-3-carboxylate |
| SMILES | CN(CC(=O)Nc1ccc(C(=O)OC(C)(C)C)cn1)S(C)(=O)=O |
| InChI | InChI=1S/C14H21N3O5S/c1-14(2,3)22-13(19)10-6-7-11(15-8-10)16-12(18)9-17(4)23(5,20)21/h6-8H,9H2,1-5H3,(H,15,16,18) |
| InChIKey | DQMXPLAEOLYHBF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |