C14H16N6O2 — CID 126836734
ethyl 1-[2-[(6-cyano-2-methylpyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate (PubChem CID 126836734) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is ethyl 1-[2-[(6-cyano-2-methylpyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate.
| Compound Name | ethyl 1-[2-[(6-cyano-2-methylpyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 126836734 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | ethyl 1-[2-[(6-cyano-2-methylpyrimidin-4-yl)amino]ethyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CCNc2cc(C#N)nc(C)n2)cn1 |
| InChI | InChI=1S/C14H16N6O2/c1-3-22-14(21)12-8-20(9-17-12)5-4-16-13-6-11(7-15)18-10(2)19-13/h6,8-9H,3-5H2,1-2H3,(H,16,18,19) |
| InChIKey | SKFLCKNFBWBDGX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |