C20H25N3O2 — CID 126840576
N-[(1-methylpyrrol-3-yl)methyl]-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide (PubChem CID 126840576) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(1-methylpyrrol-3-yl)methyl]-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide.
| Compound Name | N-[(1-methylpyrrol-3-yl)methyl]-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 126840576 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[(1-methylpyrrol-3-yl)methyl]-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide |
| SMILES | Cn1ccc(CNC(=O)N2CC(c3ccccc3)C3COCCC32)c1 |
| InChI | InChI=1S/C20H25N3O2/c1-22-9-7-15(12-22)11-21-20(24)23-13-17(16-5-3-2-4-6-16)18-14-25-10-8-19(18)23/h2-7,9,12,17-19H,8,10-11,13-14H2,1H3,(H,21,24) |
| InChIKey | ZEOXZGLKPXIKMH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |