C21H28N4O2 — CID 129347537
(3S,3aS,7aS)-N-(5-methyl-1-propan-2-ylpyrazol-3-yl)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide (PubChem CID 129347537) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is (3S,3aS,7aS)-N-(5-methyl-1-propan-2-ylpyrazol-3-yl)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide.
| Compound Name | (3S,3aS,7aS)-N-(5-methyl-1-propan-2-ylpyrazol-3-yl)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 129347537 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (3S,3aS,7aS)-N-(5-methyl-1-propan-2-ylpyrazol-3-yl)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole-1-carboxamide |
| SMILES | Cc1cc(NC(=O)N2C[C@H](c3ccccc3)[C@@H]3COCC[C@@H]32)nn1C(C)C |
| InChI | InChI=1S/C21H28N4O2/c1-14(2)25-15(3)11-20(23-25)22-21(26)24-12-17(16-7-5-4-6-8-16)18-13-27-10-9-19(18)24/h4-8,11,14,17-19H,9-10,12-13H2,1-3H3,(H,22,23,26)/t17-,18+,19+/m1/s1 |
| InChIKey | RWNKBTIEOJZYPQ-QYZOEREBSA-N |
| XLogP | 3.81 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |