C21H24N2O2 — CID 129487289
(E)-1-[(3S,3aR,7aS)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrol-1-yl]-3-(1-methylpyrrol-3-yl)prop-2-en-1-one (PubChem CID 129487289) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (E)-1-[(3S,3aR,7aS)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrol-1-yl]-3-(1-methylpyrrol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3S,3aR,7aS)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrol-1-yl]-3-(1-methylpyrrol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 129487289 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (E)-1-[(3S,3aR,7aS)-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrol-1-yl]-3-(1-methylpyrrol-3-yl)prop-2-en-1-one |
| SMILES | Cn1ccc(/C=C/C(=O)N2C[C@H](c3ccccc3)[C@H]3COCC[C@@H]32)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-22-11-9-16(13-22)7-8-21(24)23-14-18(17-5-3-2-4-6-17)19-15-25-12-10-20(19)23/h2-9,11,13,18-20H,10,12,14-15H2,1H3/b8-7+/t18-,19-,20+/m1/s1 |
| InChIKey | TWXWYOATAJIBCI-DSTKZSRVSA-N |
| XLogP | 3.07 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|