C25H17Cl3N6O9S2 — CID 126843348
2-[[2-[2-hydroxy-5-sulfo-3-[(2,5,6-trichloropyrimidin-4-yl)amino]phenyl]imino-1-phenylethyl]diazenyl]-5-sulfobenzoic acid (PubChem CID 126843348) has the molecular formula C25H17Cl3N6O9S2 and a molecular weight of 715.94 g/mol. Its IUPAC name is 2-[[2-[2-hydroxy-5-sulfo-3-[(2,5,6-trichloropyrimidin-4-yl)amino]phenyl]imino-1-phenylethyl]diazenyl]-5-sulfobenzoic acid.
| Compound Name | 2-[[2-[2-hydroxy-5-sulfo-3-[(2,5,6-trichloropyrimidin-4-yl)amino]phenyl]imino-1-phenylethyl]diazenyl]-5-sulfobenzoic acid |
|---|---|
| PubChem CID | 126843348 |
| Molecular Formula | C25H17Cl3N6O9S2 |
| Molecular Weight | 715.94 g/mol |
| Exact Mass | 713.96 |
| IUPAC Name | 2-[[2-[2-hydroxy-5-sulfo-3-[(2,5,6-trichloropyrimidin-4-yl)amino]phenyl]imino-1-phenylethyl]diazenyl]-5-sulfobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)O)ccc1/N=N/C(/C=N/c1cc(S(=O)(=O)O)cc(Nc2nc(Cl)nc(Cl)c2Cl)c1O)c1ccccc1 |
| InChI | InChI=1S/C25H17Cl3N6O9S2/c26-20-22(27)31-25(28)32-23(20)30-18-10-14(45(41,42)43)9-17(21(18)35)29-11-19(12-4-2-1-3-5-12)34-33-16-7-6-13(44(38,39)40)8-15(16)24(36)37/h1-11,19,35H,(H,36,37)(H,30,31,32)(H,38,39,40)(H,41,42,43)/b29-11+,34-33+ |
| InChIKey | IHSVPGOOKIQSJN-OVXIXVAWSA-N |
| XLogP | 6.31 |
| TPSA | 241.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.94 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|