C17H17BrN6O3 — CID 1268537
N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1268537) has the molecular formula C17H17BrN6O3 and a molecular weight of 433.27 g/mol. Its IUPAC name is N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1268537 |
| Molecular Formula | C17H17BrN6O3 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1cc(OC)c(C=NNC(=O)c2nc3nc(C)cc(C)n3n2)cc1Br |
| InChI | InChI=1S/C17H17BrN6O3/c1-9-5-10(2)24-17(20-9)21-15(23-24)16(25)22-19-8-11-6-12(18)14(27-4)7-13(11)26-3/h5-8H,1-4H3,(H,22,25) |
| InChIKey | SUISIOAGKYIRRQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|