C15H24Cl2N4O3S — CID 12694309
8,9-dimethoxy-2-methyl-4-(4-methylpiperazin-1-yl)-2λ6-thia-3,5-diazabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene 2-oxide;dihydrochloride (PubChem CID 12694309) has the molecular formula C15H24Cl2N4O3S and a molecular weight of 411.36 g/mol. Its IUPAC name is 8,9-dimethoxy-2-methyl-4-(4-methylpiperazin-1-yl)-2λ6-thia-3,5-diazabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene 2-oxide;dihydrochloride.
| Compound Name | 8,9-dimethoxy-2-methyl-4-(4-methylpiperazin-1-yl)-2λ6-thia-3,5-diazabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene 2-oxide;dihydrochloride |
|---|---|
| PubChem CID | 12694309 |
| Molecular Formula | C15H24Cl2N4O3S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 8,9-dimethoxy-2-methyl-4-(4-methylpiperazin-1-yl)-2λ6-thia-3,5-diazabicyclo[4.4.0]deca-1(10),2,4,6,8-pentaene 2-oxide;dihydrochloride |
| SMILES | COc1cc2c(cc1OC)S(C)(=O)=NC(N1CCN(C)CC1)=N2.Cl.Cl |
| InChI | InChI=1S/C15H22N4O3S.2ClH/c1-18-5-7-19(8-6-18)15-16-11-9-12(21-2)13(22-3)10-14(11)23(4,20)17-15;;/h9-10H,5-8H2,1-4H3;2*1H |
| InChIKey | KLMHZMWRPPYDTR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |