C28H40Cl2Ti — CID 126960943
CID 126960943 (PubChem CID 126960943) has the molecular formula C28H40Cl2Ti and a molecular weight of 495.40 g/mol.
| Compound Name | CID 126960943 |
|---|---|
| PubChem CID | 126960943 |
| Molecular Formula | C28H40Cl2Ti |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | — |
| SMILES | CC(C)C1C[C@H](C)CC[C@H]1[C]1[CH][CH][CH][CH]1.CC12CCC([C]3[CH][CH][CH][C]31)C2(C)C.Cl[Ti]Cl |
| InChI | InChI=1S/C15H23.C13H17.2ClH.Ti/c1-11(2)15-10-12(3)8-9-14(15)13-6-4-5-7-13;1-12(2)10-7-8-13(12,3)11-6-4-5-9(10)11;;;/h4-7,11-12,14-15H,8-10H2,1-3H3;4-6,10H,7-8H2,1-3H3;2*1H;/q;;;;+2/p-2/t12-,14+,15?;;;;/m1..../s1 |
| InChIKey | LNXXPQXVBMFBJK-CJNXFNQWSA-L |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |