C15H21ClFN3 — CID 126965807
1-(4-fluorophenyl)-N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]methanamine;hydrochloride (PubChem CID 126965807) has the molecular formula C15H21ClFN3 and a molecular weight of 297.81 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]methanamine;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 126965807 |
| Molecular Formula | C15H21ClFN3 |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]methanamine;hydrochloride |
| SMILES | CC(C)Cn1nccc1CNCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C15H20FN3.ClH/c1-12(2)11-19-15(7-8-18-19)10-17-9-13-3-5-14(16)6-4-13;/h3-8,12,17H,9-11H2,1-2H3;1H |
| InChIKey | DRIKVLINHGQUHE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |