C9H15IN2S — CID 126989435
3-iodo-5-(2,3,3-trimethylbutan-2-yl)-1,2,4-thiadiazole (PubChem CID 126989435) has the molecular formula C9H15IN2S and a molecular weight of 310.20 g/mol. Its IUPAC name is 3-iodo-5-(2,3,3-trimethylbutan-2-yl)-1,2,4-thiadiazole.
| Compound Name | 3-iodo-5-(2,3,3-trimethylbutan-2-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 126989435 |
| Molecular Formula | C9H15IN2S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 3-iodo-5-(2,3,3-trimethylbutan-2-yl)-1,2,4-thiadiazole |
| SMILES | CC(C)(C)C(C)(C)c1nc(I)ns1 |
| InChI | InChI=1S/C9H15IN2S/c1-8(2,3)9(4,5)6-11-7(10)12-13-6/h1-5H3 |
| InChIKey | BEMZUHAAHNKZEV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|