C7H12N2O — CID 126993427
2-(1,2-oxazolidin-2-yl)butanenitrile (PubChem CID 126993427) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-(1,2-oxazolidin-2-yl)butanenitrile.
| Compound Name | 2-(1,2-oxazolidin-2-yl)butanenitrile |
|---|---|
| PubChem CID | 126993427 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-(1,2-oxazolidin-2-yl)butanenitrile |
| SMILES | CCC(C#N)N1CCCO1 |
| InChI | InChI=1S/C7H12N2O/c1-2-7(6-8)9-4-3-5-10-9/h7H,2-5H2,1H3 |
| InChIKey | TWWIKTZSWVQMJE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |