C30H24Cl2N4O3 — CID 127028998
2-(1,3-benzodioxol-5-ylamino)-1-[1-benzyl-5-(4-chlorophenyl)triazol-4-yl]-1-(4-chlorophenyl)ethanol (PubChem CID 127028998) has the molecular formula C30H24Cl2N4O3 and a molecular weight of 559.45 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-1-[1-benzyl-5-(4-chlorophenyl)triazol-4-yl]-1-(4-chlorophenyl)ethanol.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-1-[1-benzyl-5-(4-chlorophenyl)triazol-4-yl]-1-(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 127028998 |
| Molecular Formula | C30H24Cl2N4O3 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-1-[1-benzyl-5-(4-chlorophenyl)triazol-4-yl]-1-(4-chlorophenyl)ethanol |
| SMILES | OC(CNc1ccc2c(c1)OCO2)(c1ccc(Cl)cc1)c1nnn(Cc2ccccc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H24Cl2N4O3/c31-23-10-6-21(7-11-23)28-29(34-35-36(28)17-20-4-2-1-3-5-20)30(37,22-8-12-24(32)13-9-22)18-33-25-14-15-26-27(16-25)39-19-38-26/h1-16,33,37H,17-19H2 |
| InChIKey | FSJQJIPHMUQEDW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|