C10H10ClN7O — CID 127030100
4-amino-6-(4-chloroanilino)-1,3,5-triazine-2-carbohydrazide (PubChem CID 127030100) has the molecular formula C10H10ClN7O and a molecular weight of 279.69 g/mol. Its IUPAC name is 4-amino-6-(4-chloroanilino)-1,3,5-triazine-2-carbohydrazide.
| Compound Name | 4-amino-6-(4-chloroanilino)-1,3,5-triazine-2-carbohydrazide |
|---|---|
| PubChem CID | 127030100 |
| Molecular Formula | C10H10ClN7O |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4-amino-6-(4-chloroanilino)-1,3,5-triazine-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(N)nc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C10H10ClN7O/c11-5-1-3-6(4-2-5)14-10-16-7(8(19)18-13)15-9(12)17-10/h1-4H,13H2,(H,18,19)(H3,12,14,15,16,17) |
| InChIKey | NPNZRXGXJGABLQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|