About (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid
(4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid (PubChem CID 127031255) has the molecular formula C4H7NO4S
and a molecular weight of 165.17 g/mol. Its IUPAC name is (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 127031255 |
| Molecular Formula | C4H7NO4S |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CS(=O)(=O)CN1 |
| InChI | InChI=1S/C4H7NO4S/c6-4(7)3-1-10(8,9)2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | IQKRCFGHLYXUOY-VKHMYHEASA-N |
| XLogP | -1.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid (CID 127031255) is (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid is O=C(O)[C@@H]1CS(=O)(=O)CN1.
What is the InChIKey of (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is IQKRCFGHLYXUOY-VKHMYHEASA-N. The full InChI is InChI=1S/C4H7NO4S/c6-4(7)3-1-10(8,9)2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m0/s1.
What are the key properties of (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid?
(4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 165.17 g/mol, XLogP of -1.58, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 127031255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).