C14H13F3N4O4 — CID 127032183
N-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 127032183) has the molecular formula C14H13F3N4O4 and a molecular weight of 358.27 g/mol. Its IUPAC name is N-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 127032183 |
| Molecular Formula | C14H13F3N4O4 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | CC1(CN2C=C(N=C2O1)[N+](=O)[O-])CNC3=CC=C(C=C3)OC(F)(F)F |
| InChI | InChI=1S/C14H13F3N4O4/c1-13(8-20-6-11(21(22)23)19-12(20)25-13)7-18-9-2-4-10(5-3-9)24-14(15,16)17/h2-6,18H,7-8H2,1H3 |
| InChIKey | MPBQPKHJUUBLBZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | 495 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|