C21H10BrF3OS2 — CID 127035998
[6-(2-bromophenyl)sulfanyl-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone (PubChem CID 127035998) has the molecular formula C21H10BrF3OS2 and a molecular weight of 479.34 g/mol. Its IUPAC name is [6-(2-bromophenyl)sulfanyl-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone.
| Compound Name | [6-(2-bromophenyl)sulfanyl-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 127035998 |
| Molecular Formula | C21H10BrF3OS2 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 477.93 |
| IUPAC Name | [6-(2-bromophenyl)sulfanyl-4,5,7-trifluoro-1-benzothiophen-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc2c(F)c(F)c(Sc3ccccc3Br)c(F)c2s1 |
| InChI | InChI=1S/C21H10BrF3OS2/c22-13-8-4-5-9-14(13)27-21-17(24)16(23)12-10-15(28-20(12)18(21)25)19(26)11-6-2-1-3-7-11/h1-10H |
| InChIKey | NIPUIMFHWDHZOW-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|