C21H8F8O2S — CID 102099610
1-[4-(4-benzoyl-2,3,5,6-tetrafluorophenyl)sulfanyl-2,3,5,6-tetrafluorophenyl]ethanone (PubChem CID 102099610) has the molecular formula C21H8F8O2S and a molecular weight of 476.34 g/mol. Its IUPAC name is 1-[4-(4-benzoyl-2,3,5,6-tetrafluorophenyl)sulfanyl-2,3,5,6-tetrafluorophenyl]ethanone.
| Compound Name | 1-[4-(4-benzoyl-2,3,5,6-tetrafluorophenyl)sulfanyl-2,3,5,6-tetrafluorophenyl]ethanone |
|---|---|
| PubChem CID | 102099610 |
| Molecular Formula | C21H8F8O2S |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 1-[4-(4-benzoyl-2,3,5,6-tetrafluorophenyl)sulfanyl-2,3,5,6-tetrafluorophenyl]ethanone |
| SMILES | CC(=O)c1c(F)c(F)c(Sc2c(F)c(F)c(C(=O)c3ccccc3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C21H8F8O2S/c1-7(30)9-11(22)15(26)20(16(27)12(9)23)32-21-17(28)13(24)10(14(25)18(21)29)19(31)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | KBFLSTHJKLDSHI-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|