C15H13ClF4O4S2 — CID 158257882
chloro 4-benzoyl-2,3,5,6-tetrafluorobenzenesulfonate;ethane;sulfane (PubChem CID 158257882) has the molecular formula C15H13ClF4O4S2 and a molecular weight of 432.84 g/mol. Its IUPAC name is chloro 4-benzoyl-2,3,5,6-tetrafluorobenzenesulfonate;ethane;sulfane.
| Compound Name | chloro 4-benzoyl-2,3,5,6-tetrafluorobenzenesulfonate;ethane;sulfane |
|---|---|
| PubChem CID | 158257882 |
| Molecular Formula | C15H13ClF4O4S2 |
| Molecular Weight | 432.84 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | chloro 4-benzoyl-2,3,5,6-tetrafluorobenzenesulfonate;ethane;sulfane |
| SMILES | CC.O=C(c1ccccc1)c1c(F)c(F)c(S(=O)(=O)OCl)c(F)c1F.S |
| InChI | InChI=1S/C13H5ClF4O4S.C2H6.H2S/c14-22-23(20,21)13-10(17)8(15)7(9(16)11(13)18)12(19)6-4-2-1-3-5-6;1-2;/h1-5H;1-2H3;1H2 |
| InChIKey | GHMSRBPJGUNHJZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|