C35H40N3OSSe+ — CID 127043119
piperidin-1-yl-[5-(7,10,10-trimethyl-3-selena-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4,6(11),12,14,16,21(25)-heptaen-14-yl)thiophen-2-yl]methanone (PubChem CID 127043119) has the molecular formula C35H40N3OSSe+ and a molecular weight of 629.75 g/mol. Its IUPAC name is piperidin-1-yl-[5-(7,10,10-trimethyl-3-selena-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4,6(11),12,14,16,21(25)-heptaen-14-yl)thiophen-2-yl]methanone.
| Compound Name | piperidin-1-yl-[5-(7,10,10-trimethyl-3-selena-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4,6(11),12,14,16,21(25)-heptaen-14-yl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 127043119 |
| Molecular Formula | C35H40N3OSSe+ |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | piperidin-1-yl-[5-(7,10,10-trimethyl-3-selena-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4,6(11),12,14,16,21(25)-heptaen-14-yl)thiophen-2-yl]methanone |
| SMILES | CN1CCC(C)(C)c2cc3c(cc21)[Se]c1c2c4c(cc1=C3c1ccc(C(=O)N3CCCCC3)s1)CCC[N+]=4CCC2 |
| InChI | InChI=1S/C35H40N3OSSe/c1-35(2)13-18-36(3)27-21-30-24(20-26(27)35)31(28-11-12-29(40-28)34(39)38-14-5-4-6-15-38)25-19-22-9-7-16-37-17-8-10-23(32(22)37)33(25)41-30/h11-12,19-21H,4-10,13-18H2,1-3H3/q+1 |
| InChIKey | NOWWWDMCHYVHPH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|