C36H35N3O9 — CID 127047287
4-[3-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one (PubChem CID 127047287) has the molecular formula C36H35N3O9 and a molecular weight of 653.69 g/mol. Its IUPAC name is 4-[3-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one.
| Compound Name | 4-[3-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one |
|---|---|
| PubChem CID | 127047287 |
| Molecular Formula | C36H35N3O9 |
| Molecular Weight | 653.69 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | 4-[3-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)ccc1OCc1cn(CCCOc2cc(=O)oc3ccccc23)nn1 |
| InChI | InChI=1S/C36H35N3O9/c1-42-32-18-24(10-13-27(40)14-11-25-19-33(43-2)36(45-4)34(20-25)44-3)12-15-30(32)47-23-26-22-39(38-37-26)16-7-17-46-31-21-35(41)48-29-9-6-5-8-28(29)31/h5-6,8-15,18-22H,7,16-17,23H2,1-4H3/b13-10+,14-11+ |
| InChIKey | YITASHZRJQWWGI-IFQMDVHZSA-N |
| XLogP | 5.76 |
| TPSA | 133.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|