C33H37N3O6 — CID 127048845
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]acetate (PubChem CID 127048845) has the molecular formula C33H37N3O6 and a molecular weight of 571.67 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 127048845 |
| Molecular Formula | C33H37N3O6 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]acetate |
| SMILES | C[C@]12CC[C@H](OC(=O)Cn3cc(COc4cc(=O)oc5ccccc45)nn3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C33H37N3O6/c1-32-13-11-22(15-20(32)7-8-23-25-9-10-29(37)33(25,2)14-12-26(23)32)41-31(39)18-36-17-21(34-35-36)19-40-28-16-30(38)42-27-6-4-3-5-24(27)28/h3-7,16-17,22-23,25-26H,8-15,18-19H2,1-2H3/t22-,23-,25-,26-,32-,33-/m0/s1 |
| InChIKey | TXOQAEYMEFQCKY-SFZGMJDZSA-N |
| XLogP | 5.41 |
| TPSA | 113.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|