C15H28N2 — CID 12708997
(E)-N'-cyclohexyl-N,N-diethylpent-3-enimidamide (PubChem CID 12708997) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (E)-N'-cyclohexyl-N,N-diethylpent-3-enimidamide.
| Compound Name | (E)-N'-cyclohexyl-N,N-diethylpent-3-enimidamide |
|---|---|
| PubChem CID | 12708997 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (E)-N'-cyclohexyl-N,N-diethylpent-3-enimidamide |
| SMILES | C/C=C/C/C(=N\C1CCCCC1)N(CC)CC |
| InChI | InChI=1S/C15H28N2/c1-4-7-13-15(17(5-2)6-3)16-14-11-9-8-10-12-14/h4,7,14H,5-6,8-13H2,1-3H3/b7-4+,16-15+ |
| InChIKey | HVWVNOUXJPWPLO-GLARZXSESA-N |
| XLogP | 4.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|