C18H17NO3 — CID 12717857
6-ethoxy-6,9,10,11-tetrahydrochromeno[4,3-b]quinolin-8-one (PubChem CID 12717857) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 6-ethoxy-6,9,10,11-tetrahydrochromeno[4,3-b]quinolin-8-one.
| Compound Name | 6-ethoxy-6,9,10,11-tetrahydrochromeno[4,3-b]quinolin-8-one |
|---|---|
| PubChem CID | 12717857 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 6-ethoxy-6,9,10,11-tetrahydrochromeno[4,3-b]quinolin-8-one |
| SMILES | CCOC1Oc2ccccc2-c2nc3c(cc21)C(=O)CCC3 |
| InChI | InChI=1S/C18H17NO3/c1-2-21-18-13-10-12-14(7-5-8-15(12)20)19-17(13)11-6-3-4-9-16(11)22-18/h3-4,6,9-10,18H,2,5,7-8H2,1H3 |
| InChIKey | HHZWXGLZXQWCDV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |