C20H19N5O6 — CID 127244219
N-[(E)-[3-ethoxy-4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methylideneamino]-4-nitrobenzamide (PubChem CID 127244219) has the molecular formula C20H19N5O6 and a molecular weight of 425.40 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-[3-ethoxy-4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 127244219 |
| Molecular Formula | C20H19N5O6 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methylideneamino]-4-nitrobenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2)ccc1OCc1nonc1C |
| InChI | InChI=1S/C20H19N5O6/c1-3-29-19-10-14(4-9-18(19)30-12-17-13(2)23-31-24-17)11-21-22-20(26)15-5-7-16(8-6-15)25(27)28/h4-11H,3,12H2,1-2H3,(H,22,26)/b21-11+ |
| InChIKey | WGQFYNMGBSKMRZ-SRZZPIQSSA-N |
| XLogP | 3.03 |
| TPSA | 141.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|